C15H19NO2 — CID 4025749
4-(4-methoxyphenyl)-2,2-dimethyloxane-4-carbonitrile (PubChem CID 4025749) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,2-dimethyloxane-4-carbonitrile.
| Compound Name | 4-(4-methoxyphenyl)-2,2-dimethyloxane-4-carbonitrile |
|---|---|
| PubChem CID | 4025749 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,2-dimethyloxane-4-carbonitrile |
| SMILES | COc1ccc(C2(C#N)CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C15H19NO2/c1-14(2)10-15(11-16,8-9-18-14)12-4-6-13(17-3)7-5-12/h4-7H,8-10H2,1-3H3 |
| InChIKey | DVOVAOKOPBLQHG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |