C12H11N5O4 — CID 4028568
5-methyl-N'-(3-nitrobenzoyl)-1H-pyrazole-3-carbohydrazide (PubChem CID 4028568) has the molecular formula C12H11N5O4 and a molecular weight of 289.25 g/mol. Its IUPAC name is 5-methyl-N'-(3-nitrobenzoyl)-1H-pyrazole-3-carbohydrazide.
| Compound Name | 5-methyl-N'-(3-nitrobenzoyl)-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 4028568 |
| Molecular Formula | C12H11N5O4 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 5-methyl-N'-(3-nitrobenzoyl)-1H-pyrazole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)n[nH]1 |
| InChI | InChI=1S/C12H11N5O4/c1-7-5-10(14-13-7)12(19)16-15-11(18)8-3-2-4-9(6-8)17(20)21/h2-6H,1H3,(H,13,14)(H,15,18)(H,16,19) |
| InChIKey | QKMVWKSVCHEOJQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|