C24H21ClN2O4 — CID 4029042
4-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 4029042) has the molecular formula C24H21ClN2O4 and a molecular weight of 436.90 g/mol. Its IUPAC name is 4-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 4029042 |
| Molecular Formula | C24H21ClN2O4 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 4-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COc1cccc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21ClN2O4/c1-30-19-4-2-3-17(22(19)31-13-14-5-9-18(25)10-6-14)12-26-27-23(28)20-15-7-8-16(11-15)21(20)24(27)29/h2-10,12,15-16,20-21H,11,13H2,1H3 |
| InChIKey | SKYHYJWVWIRJIV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|