C32H36ClN3O2 — CID 4029648
2-chloro-N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-hexylbenzamide (PubChem CID 4029648) has the molecular formula C32H36ClN3O2 and a molecular weight of 530.11 g/mol. Its IUPAC name is 2-chloro-N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-hexylbenzamide.
| Compound Name | 2-chloro-N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-hexylbenzamide |
|---|---|
| PubChem CID | 4029648 |
| Molecular Formula | C32H36ClN3O2 |
| Molecular Weight | 530.11 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 2-chloro-N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-hexylbenzamide |
| SMILES | CCCCCCN(C(=O)c1ccccc1Cl)C(CC)c1nc2ccccc2c(=O)n1-c1ccc(CC)cc1 |
| InChI | InChI=1S/C32H36ClN3O2/c1-4-7-8-13-22-35(31(37)25-14-9-11-16-27(25)33)29(6-3)30-34-28-17-12-10-15-26(28)32(38)36(30)24-20-18-23(5-2)19-21-24/h9-12,14-21,29H,4-8,13,22H2,1-3H3 |
| InChIKey | VOHJFWILLUNULO-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.11 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|