C11H12O4S — CID 4029682
4-(benzenesulfonyl)cyclopent-4-ene-1,3-diol (PubChem CID 4029682) has the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. Its IUPAC name is 4-(benzenesulfonyl)cyclopent-4-ene-1,3-diol.
| Compound Name | 4-(benzenesulfonyl)cyclopent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 4029682 |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 4-(benzenesulfonyl)cyclopent-4-ene-1,3-diol |
| SMILES | O=S(=O)(C1=CC(O)CC1O)c1ccccc1 |
| InChI | InChI=1S/C11H12O4S/c12-8-6-10(13)11(7-8)16(14,15)9-4-2-1-3-5-9/h1-5,7-8,10,12-13H,6H2 |
| InChIKey | YXBOEPXHXCGIQZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |