C19H14ClN3O3S — CID 4030206
6-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile (PubChem CID 4030206) has the molecular formula C19H14ClN3O3S and a molecular weight of 399.86 g/mol. Its IUPAC name is 6-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 4030206 |
| Molecular Formula | C19H14ClN3O3S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 6-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cc(-c2[nH]c(=S)[nH]c(=O)c2C#N)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14ClN3O3S/c1-25-16-8-12(17-14(9-21)18(24)23-19(27)22-17)4-7-15(16)26-10-11-2-5-13(20)6-3-11/h2-8H,10H2,1H3,(H2,22,23,24,27) |
| InChIKey | AFKGODIFNLUKQE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|