About [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate
[2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate (PubChem CID 4030942) has the molecular formula C18H17N3O6S2
and a molecular weight of 435.48 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate.
Molecular Properties
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate |
| PubChem CID | 4030942 |
| Molecular Formula | C18H17N3O6S2 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COC(=O)CC2Sc3ccccc3NC2=O)c1 |
| InChI | InChI=1S/C18H17N3O6S2/c19-29(25,26)12-5-3-4-11(8-12)20-16(22)10-27-17(23)9-15-18(24)21-13-6-1-2-7-14(13)28-15/h1-8,15H,9-10H2,(H,20,22)(H,21,24)(H2,19,25,26) |
| InChIKey | WVOJGZOPQXOXND-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
The IUPAC name of [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate (CID 4030942) is [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate.
What is the SMILES notation for [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
The canonical SMILES for [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate is NS(=O)(=O)c1cccc(NC(=O)COC(=O)CC2Sc3ccccc3NC2=O)c1.
What is the InChIKey of [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
The InChIKey is WVOJGZOPQXOXND-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O6S2/c19-29(25,26)12-5-3-4-11(8-12)20-16(22)10-27-17(23)9-15-18(24)21-13-6-1-2-7-14(13)28-15/h1-8,15H,9-10H2,(H,20,22)(H,21,24)(H2,19,25,26).
What are the key properties of [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
[2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate has a molecular weight of 435.48 g/mol, XLogP of 1.32, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate is sourced from PubChem (CID 4030942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).