C22H21BrN2O3S — CID 4031441
4-[2-(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-1-yl]benzenesulfonamide (PubChem CID 4031441) has the molecular formula C22H21BrN2O3S and a molecular weight of 473.39 g/mol. Its IUPAC name is 4-[2-(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-1-yl]benzenesulfonamide.
| Compound Name | 4-[2-(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 4031441 |
| Molecular Formula | C22H21BrN2O3S |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 4-[2-(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-1-yl]benzenesulfonamide |
| SMILES | CC1(C)CC(=O)c2cc(-c3ccc(Br)cc3)n(-c3ccc(S(N)(=O)=O)cc3)c2C1 |
| InChI | InChI=1S/C22H21BrN2O3S/c1-22(2)12-20-18(21(26)13-22)11-19(14-3-5-15(23)6-4-14)25(20)16-7-9-17(10-8-16)29(24,27)28/h3-11H,12-13H2,1-2H3,(H2,24,27,28) |
| InChIKey | IAZXGAHOPSPEPV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|