About 2,6-Difluorophenyl isothiocyanate
2,6-Difluorophenyl isothiocyanate (PubChem CID 4031601) has the molecular formula C7H3F2NS
and a molecular weight of 171.17 g/mol. Its IUPAC name is 1,3-difluoro-2-isothiocyanatobenzene.
Molecular Properties
| Compound Name | 2,6-Difluorophenyl isothiocyanate |
| PubChem CID | 4031601 |
| Molecular Formula | C7H3F2NS |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.00 |
| IUPAC Name | 1,3-difluoro-2-isothiocyanatobenzene |
| SMILES | C1=CC(=C(C(=C1)F)N=C=S)F |
| InChI | InChI=1S/C7H3F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| InChIKey | DBSXNGIBAKYMSS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 169 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,6-Difluorophenyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-Difluorophenyl isothiocyanate?
The IUPAC name of 2,6-Difluorophenyl isothiocyanate (CID 4031601) is 1,3-difluoro-2-isothiocyanatobenzene.
What is the SMILES notation for 2,6-Difluorophenyl isothiocyanate?
The canonical SMILES for 2,6-Difluorophenyl isothiocyanate is C1=CC(=C(C(=C1)F)N=C=S)F.
What is the InChIKey of 2,6-Difluorophenyl isothiocyanate?
The InChIKey is DBSXNGIBAKYMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H.
What are the key properties of 2,6-Difluorophenyl isothiocyanate?
2,6-Difluorophenyl isothiocyanate has a molecular weight of 171.17 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-Difluorophenyl isothiocyanate is sourced from PubChem (CID 4031601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).