C39H58N2O7S — CID 4032374
[10-cyclopentylsulfanyl-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-yl] N-ethylcarbamate (PubChem CID 4032374) has the molecular formula C39H58N2O7S and a molecular weight of 698.97 g/mol. Its IUPAC name is [10-cyclopentylsulfanyl-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-yl] N-ethylcarbamate.
| Compound Name | [10-cyclopentylsulfanyl-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 4032374 |
| Molecular Formula | C39H58N2O7S |
| Molecular Weight | 698.97 g/mol |
| Exact Mass | 698.40 |
| IUPAC Name | [10-cyclopentylsulfanyl-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-yl] N-ethylcarbamate |
| SMILES | C=CCOC12Oc3ccc(OC(=O)NCC)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC(C)(C)C)CC1SC1CCCC1)C32 |
| InChI | InChI=1S/C39H58N2O7S/c1-6-22-45-39-34(49-28-15-8-9-16-28)25-32(41-48-38(3,4)5)30-23-26(14-10-12-20-42)29(17-11-13-21-43)35(36(30)39)31-24-27(18-19-33(31)47-39)46-37(44)40-7-2/h6,18-19,23-24,26,28-29,34-36,42-43H,1,7-17,20-22,25H2,2-5H3,(H,40,44) |
| InChIKey | BRECVKFCLHSOND-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.97 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|