C25H19ClN2O2S — CID 4032661
4-(4-chlorophenyl)-2-(4-ethylphenyl)-4,5-dihydropyrrolo[3,4-b][1,5]benzothiazepine-1,3-dione (PubChem CID 4032661) has the molecular formula C25H19ClN2O2S and a molecular weight of 446.96 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(4-ethylphenyl)-4,5-dihydropyrrolo[3,4-b][1,5]benzothiazepine-1,3-dione.
| Compound Name | 4-(4-chlorophenyl)-2-(4-ethylphenyl)-4,5-dihydropyrrolo[3,4-b][1,5]benzothiazepine-1,3-dione |
|---|---|
| PubChem CID | 4032661 |
| Molecular Formula | C25H19ClN2O2S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(4-ethylphenyl)-4,5-dihydropyrrolo[3,4-b][1,5]benzothiazepine-1,3-dione |
| SMILES | CCc1ccc(N2C(=O)C3=C(C2=O)C(c2ccc(Cl)cc2)Nc2ccccc2S3)cc1 |
| InChI | InChI=1S/C25H19ClN2O2S/c1-2-15-7-13-18(14-8-15)28-24(29)21-22(16-9-11-17(26)12-10-16)27-19-5-3-4-6-20(19)31-23(21)25(28)30/h3-14,22,27H,2H2,1H3 |
| InChIKey | LJDGHNCJLGXDNC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|