C31H36N2O3 — CID 4034041
4-tert-butyl-N-[3-[[2-(4-cyclohexylphenoxy)acetyl]amino]phenyl]benzamide (PubChem CID 4034041) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[[2-(4-cyclohexylphenoxy)acetyl]amino]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[[2-(4-cyclohexylphenoxy)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 4034041 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 4-tert-butyl-N-[3-[[2-(4-cyclohexylphenoxy)acetyl]amino]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(NC(=O)COc3ccc(C4CCCCC4)cc3)c2)cc1 |
| InChI | InChI=1S/C31H36N2O3/c1-31(2,3)25-16-12-24(13-17-25)30(35)33-27-11-7-10-26(20-27)32-29(34)21-36-28-18-14-23(15-19-28)22-8-5-4-6-9-22/h7,10-20,22H,4-6,8-9,21H2,1-3H3,(H,32,34)(H,33,35) |
| InChIKey | IXLZRVAFXPBVNF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |