C15H10F9NO5 — CID 4034737
methyl 2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-hydroxy-2-oxo-3-(trifluoromethyl)indol-1-yl]acetate (PubChem CID 4034737) has the molecular formula C15H10F9NO5 and a molecular weight of 455.23 g/mol. Its IUPAC name is methyl 2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-hydroxy-2-oxo-3-(trifluoromethyl)indol-1-yl]acetate.
| Compound Name | methyl 2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-hydroxy-2-oxo-3-(trifluoromethyl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 4034737 |
| Molecular Formula | C15H10F9NO5 |
| Molecular Weight | 455.23 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | methyl 2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-hydroxy-2-oxo-3-(trifluoromethyl)indol-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C(O)(C(F)(F)F)c2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C15H10F9NO5/c1-30-9(26)5-25-8-3-2-6(12(29,14(19,20)21)15(22,23)24)4-7(8)11(28,10(25)27)13(16,17)18/h2-4,28-29H,5H2,1H3 |
| InChIKey | ZWKWVMXPEMBEBR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |