C25H21N5O4S — CID 4034769
2-methyl-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid (PubChem CID 4034769) has the molecular formula C25H21N5O4S and a molecular weight of 487.54 g/mol. Its IUPAC name is 2-methyl-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid.
| Compound Name | 2-methyl-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid |
|---|---|
| PubChem CID | 4034769 |
| Molecular Formula | C25H21N5O4S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 2-methyl-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid |
| SMILES | CC1CC(=Cc2ccc(Sc3nncn3C)c([N+](=O)[O-])c2)c2nc3ccccc3c(C(=O)O)c2C1 |
| InChI | InChI=1S/C25H21N5O4S/c1-14-9-16(23-18(10-14)22(24(31)32)17-5-3-4-6-19(17)27-23)11-15-7-8-21(20(12-15)30(33)34)35-25-28-26-13-29(25)2/h3-8,11-14H,9-10H2,1-2H3,(H,31,32) |
| InChIKey | PWHLONUIFSTYPO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|