C15H19NO4S — CID 4035368
1-benzyl-2-methyl-5,5-dioxo-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole-3-carboxylic acid (PubChem CID 4035368) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-benzyl-2-methyl-5,5-dioxo-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole-3-carboxylic acid.
| Compound Name | 1-benzyl-2-methyl-5,5-dioxo-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 4035368 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-benzyl-2-methyl-5,5-dioxo-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole-3-carboxylic acid |
| SMILES | CC1C(C(=O)O)C2CS(=O)(=O)CC2N1Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO4S/c1-10-14(15(17)18)12-8-21(19,20)9-13(12)16(10)7-11-5-3-2-4-6-11/h2-6,10,12-14H,7-9H2,1H3,(H,17,18) |
| InChIKey | OKBWLSIGTRAHDH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |