About bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+)
bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+) (PubChem CID 4036118) has the molecular formula C14H10Br4MnO6+4
and a molecular weight of 648.78 g/mol. Its IUPAC name is bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+).
Molecular Properties
| Compound Name | bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+) |
| PubChem CID | 4036118 |
| Molecular Formula | C14H10Br4MnO6+4 |
| Molecular Weight | 648.78 g/mol |
| Exact Mass | 644.66 |
| IUPAC Name | bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+) |
| SMILES | O=C([OH2+])c1cc(Br)cc(Br)c1O.O=C([OH2+])c1cc(Br)cc(Br)c1O.[Mn+2] |
| InChI | InChI=1S/2C7H4Br2O3.Mn/c2*8-3-1-4(7(11)12)6(10)5(9)2-3;/h2*1-2,10H,(H,11,12);/q;;+2/p+2 |
| InChIKey | PXJVFGYQVWVRLZ-UHFFFAOYSA-P |
| XLogP | 3.56 |
| TPSA | 120.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 648.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+)?
The IUPAC name of bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+) (CID 4036118) is bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+).
What is the SMILES notation for bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+)?
The canonical SMILES for bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+) is O=C([OH2+])c1cc(Br)cc(Br)c1O.O=C([OH2+])c1cc(Br)cc(Br)c1O.[Mn+2].
What is the InChIKey of bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+)?
The InChIKey is PXJVFGYQVWVRLZ-UHFFFAOYSA-P. The full InChI is InChI=1S/2C7H4Br2O3.Mn/c2*8-3-1-4(7(11)12)6(10)5(9)2-3;/h2*1-2,10H,(H,11,12);/q;;+2/p+2.
What are the key properties of bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+)?
bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+) has a molecular weight of 648.78 g/mol, XLogP of 3.56, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((3,5-dibromo-2-hydroxybenzoyl)oxidanium);manganese(2+) is sourced from PubChem (CID 4036118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).