About 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one
3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one (PubChem CID 4036205) has the molecular formula C18H25NO3
and a molecular weight of 303.40 g/mol. Its IUPAC name is 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one |
| PubChem CID | 4036205 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one |
| SMILES | CC(C)=CCCC1(C)OC(=O)N(Cc2ccccc2)C1(C)O |
| InChI | InChI=1S/C18H25NO3/c1-14(2)9-8-12-17(3)18(4,21)19(16(20)22-17)13-15-10-6-5-7-11-15/h5-7,9-11,21H,8,12-13H2,1-4H3 |
| InChIKey | FKRFVQBBBINMFD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one (CID 4036205) is 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one is CC(C)=CCCC1(C)OC(=O)N(Cc2ccccc2)C1(C)O.
What is the InChIKey of 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one?
The InChIKey is FKRFVQBBBINMFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO3/c1-14(2)9-8-12-17(3)18(4,21)19(16(20)22-17)13-15-10-6-5-7-11-15/h5-7,9-11,21H,8,12-13H2,1-4H3.
What are the key properties of 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one?
3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one has a molecular weight of 303.40 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 4036205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).