C13H14N2O5 — CID 4036780
1',5-dimethyl-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 4036780) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 1',5-dimethyl-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 1',5-dimethyl-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 4036780 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1',5-dimethyl-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CN1C(=O)C2(OCC(C)([N+](=O)[O-])CO2)c2ccccc21 |
| InChI | InChI=1S/C13H14N2O5/c1-12(15(17)18)7-19-13(20-8-12)9-5-3-4-6-10(9)14(2)11(13)16/h3-6H,7-8H2,1-2H3 |
| InChIKey | NAWXMKLQYPGUBU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|