About 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile
3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile (PubChem CID 4038790) has the molecular formula C12H15NO2S
and a molecular weight of 237.32 g/mol. Its IUPAC name is 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile.
Molecular Properties
| Compound Name | 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile |
| PubChem CID | 4038790 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile |
| SMILES | Cc1cc(C)c(S(=O)(=O)CCC#N)c(C)c1 |
| InChI | InChI=1S/C12H15NO2S/c1-9-7-10(2)12(11(3)8-9)16(14,15)6-4-5-13/h7-8H,4,6H2,1-3H3 |
| InChIKey | KZQCODJYLKCGKT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile?
The IUPAC name of 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile (CID 4038790) is 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile.
What is the SMILES notation for 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile?
The canonical SMILES for 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile is Cc1cc(C)c(S(=O)(=O)CCC#N)c(C)c1.
What is the InChIKey of 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile?
The InChIKey is KZQCODJYLKCGKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2S/c1-9-7-10(2)12(11(3)8-9)16(14,15)6-4-5-13/h7-8H,4,6H2,1-3H3.
What are the key properties of 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile?
3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile has a molecular weight of 237.32 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4,6-trimethylphenyl)sulfonylpropanenitrile is sourced from PubChem (CID 4038790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).