C25H27ClN4O5 — CID 4039210
N-butyl-N-[2-[2-(4-chlorophenyl)-3-oxo-5-propan-2-yl-1H-pyrazol-4-yl]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 4039210) has the molecular formula C25H27ClN4O5 and a molecular weight of 498.97 g/mol. Its IUPAC name is N-butyl-N-[2-[2-(4-chlorophenyl)-3-oxo-5-propan-2-yl-1H-pyrazol-4-yl]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-butyl-N-[2-[2-(4-chlorophenyl)-3-oxo-5-propan-2-yl-1H-pyrazol-4-yl]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4039210 |
| Molecular Formula | C25H27ClN4O5 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-butyl-N-[2-[2-(4-chlorophenyl)-3-oxo-5-propan-2-yl-1H-pyrazol-4-yl]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | CCCCN(CC(=O)c1c(C(C)C)[nH]n(-c2ccc(Cl)cc2)c1=O)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H27ClN4O5/c1-4-5-14-28(24(32)17-6-10-20(11-7-17)30(34)35)15-21(31)22-23(16(2)3)27-29(25(22)33)19-12-8-18(26)9-13-19/h6-13,16,27H,4-5,14-15H2,1-3H3 |
| InChIKey | VFZZPUCZXBIRQY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|