C23H32N2O — CID 4039771
4-(5,7-ditert-butyl-2,3-dihydro-1,3-benzoxazol-2-yl)-N,N-dimethylaniline (PubChem CID 4039771) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is 4-(5,7-ditert-butyl-2,3-dihydro-1,3-benzoxazol-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(5,7-ditert-butyl-2,3-dihydro-1,3-benzoxazol-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 4039771 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 4-(5,7-ditert-butyl-2,3-dihydro-1,3-benzoxazol-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2Nc3cc(C(C)(C)C)cc(C(C)(C)C)c3O2)cc1 |
| InChI | InChI=1S/C23H32N2O/c1-22(2,3)16-13-18(23(4,5)6)20-19(14-16)24-21(26-20)15-9-11-17(12-10-15)25(7)8/h9-14,21,24H,1-8H3 |
| InChIKey | RZOVCRAENYZXDS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'tert_butyl_A(2)', 'substructure': 'N/A'} |
|---|