C19H22N2O3S — CID 4040897
2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-methylcyclohexyl)acetamide (PubChem CID 4040897) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-methylcyclohexyl)acetamide.
| Compound Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 4040897 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-methylcyclohexyl)acetamide |
| SMILES | CC1CCCCC1NC(=O)CN1c2cccc3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C19H22N2O3S/c1-13-6-2-3-9-15(13)20-18(22)12-21-16-10-4-7-14-8-5-11-17(19(14)16)25(21,23)24/h4-5,7-8,10-11,13,15H,2-3,6,9,12H2,1H3,(H,20,22) |
| InChIKey | IXOPWXYUGFGVIH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |