C20H19FN2O2S2 — CID 4041608
10-[2-(2-fluorophenoxy)ethylsulfanyl]-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 4041608) has the molecular formula C20H19FN2O2S2 and a molecular weight of 402.52 g/mol. Its IUPAC name is 10-[2-(2-fluorophenoxy)ethylsulfanyl]-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[2-(2-fluorophenoxy)ethylsulfanyl]-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 4041608 |
| Molecular Formula | C20H19FN2O2S2 |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 10-[2-(2-fluorophenoxy)ethylsulfanyl]-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | C=CCn1c(SCCOc2ccccc2F)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C20H19FN2O2S2/c1-2-10-23-19(24)17-13-6-5-9-16(13)27-18(17)22-20(23)26-12-11-25-15-8-4-3-7-14(15)21/h2-4,7-8H,1,5-6,9-12H2 |
| InChIKey | VPJUAYRGXLVLAJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|