C11H20N4S — CID 4041756
2-[(2,6-dimethylpiperidin-1-yl)methyl]-4-methyl-1,2,4-triazole-3-thione (PubChem CID 4041756) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is 2-[(2,6-dimethylpiperidin-1-yl)methyl]-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(2,6-dimethylpiperidin-1-yl)methyl]-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 4041756 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-[(2,6-dimethylpiperidin-1-yl)methyl]-4-methyl-1,2,4-triazole-3-thione |
| SMILES | CC1CCCC(C)N1Cn1ncn(C)c1=S |
| InChI | InChI=1S/C11H20N4S/c1-9-5-4-6-10(2)14(9)8-15-11(16)13(3)7-12-15/h7,9-10H,4-6,8H2,1-3H3 |
| InChIKey | TXDUKDIGBMQASO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|