C20H21N2O5S- — CID 4043078
3-[3-amino-2-cyano-1-(3-methoxyphenyl)-3-sulfanylidenepropyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate (PubChem CID 4043078) has the molecular formula C20H21N2O5S- and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-[3-amino-2-cyano-1-(3-methoxyphenyl)-3-sulfanylidenepropyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate.
| Compound Name | 3-[3-amino-2-cyano-1-(3-methoxyphenyl)-3-sulfanylidenepropyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
|---|---|
| PubChem CID | 4043078 |
| Molecular Formula | C20H21N2O5S- |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-[3-amino-2-cyano-1-(3-methoxyphenyl)-3-sulfanylidenepropyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
| SMILES | COc1cccc(C(C2=C([O-])OC3(CCCCC3)OC2=O)C(C#N)C(N)=S)c1 |
| InChI | InChI=1S/C20H22N2O5S/c1-25-13-7-5-6-12(10-13)15(14(11-21)17(22)28)16-18(23)26-20(27-19(16)24)8-3-2-4-9-20/h5-7,10,14-15,23H,2-4,8-9H2,1H3,(H2,22,28)/p-1 |
| InChIKey | DSWLLZGCBANZDN-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|