About 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one
3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 4043158) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one |
| PubChem CID | 4043158 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CN(C)NC1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C10H18N2O/c1-10(2)6-8(11-12(3)4)5-9(13)7-10/h5,11H,6-7H2,1-4H3 |
| InChIKey | QNTKVYPREDLLLH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one?
The IUPAC name of 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one (CID 4043158) is 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one is CN(C)NC1=CC(=O)CC(C)(C)C1.
What is the InChIKey of 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one?
The InChIKey is QNTKVYPREDLLLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-10(2)6-8(11-12(3)4)5-9(13)7-10/h5,11H,6-7H2,1-4H3.
What are the key properties of 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one?
3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one has a molecular weight of 182.27 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylhydrazinyl)-5,5-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 4043158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).