About Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate
Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate (PubChem CID 4043289) has the molecular formula C22H21NO4S
and a molecular weight of 395.50 g/mol. Its IUPAC name is benzhydryl 2-[(4-methylphenyl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate |
| PubChem CID | 4043289 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | benzhydryl 2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCC(=O)OC(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | InChI=1S/C22H21NO4S/c1-17-12-14-20(15-13-17)28(25,26)23-16-21(24)27-22(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,22-23H,16H2,1H3 |
| InChIKey | ZMTWPGRWULXMQR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | 562 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate?
The IUPAC name of Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate (CID 4043289) is benzhydryl 2-[(4-methylphenyl)sulfonylamino]acetate.
What is the SMILES notation for Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate?
The canonical SMILES for Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate is CC1=CC=C(C=C1)S(=O)(=O)NCC(=O)OC(C2=CC=CC=C2)C3=CC=CC=C3.
What is the InChIKey of Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate?
The InChIKey is ZMTWPGRWULXMQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO4S/c1-17-12-14-20(15-13-17)28(25,26)23-16-21(24)27-22(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,22-23H,16H2,1H3.
What are the key properties of Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate?
Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate has a molecular weight of 395.50 g/mol, XLogP of 4.40, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Benzhydryl 2-{[(4-methylphenyl)sulfonyl]amino}acetate is sourced from PubChem (CID 4043289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).