C29H34N2O6 — CID 4044215
(4-ethoxyphenyl)-[1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxo-2-(4-prop-2-enoxyphenyl)pyrrolidin-3-ylidene]methanolate (PubChem CID 4044215) has the molecular formula C29H34N2O6 and a molecular weight of 506.60 g/mol. Its IUPAC name is (4-ethoxyphenyl)-[1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxo-2-(4-prop-2-enoxyphenyl)pyrrolidin-3-ylidene]methanolate.
| Compound Name | (4-ethoxyphenyl)-[1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxo-2-(4-prop-2-enoxyphenyl)pyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 4044215 |
| Molecular Formula | C29H34N2O6 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (4-ethoxyphenyl)-[1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxo-2-(4-prop-2-enoxyphenyl)pyrrolidin-3-ylidene]methanolate |
| SMILES | C=CCOc1ccc(C2C(=C([O-])c3ccc(OCC)cc3)C(=O)C(=O)N2CCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C29H34N2O6/c1-3-18-37-24-10-6-21(7-11-24)26-25(27(32)22-8-12-23(13-9-22)36-4-2)28(33)29(34)31(26)15-5-14-30-16-19-35-20-17-30/h3,6-13,26,32H,1,4-5,14-20H2,2H3 |
| InChIKey | AURUTDIBVYSXNH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|