C19H15FN2O3 — CID 4045583
5-(2,6-dimethylphenyl)-3-(4-fluorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 4045583) has the molecular formula C19H15FN2O3 and a molecular weight of 338.34 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-3-(4-fluorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-(2,6-dimethylphenyl)-3-(4-fluorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 4045583 |
| Molecular Formula | C19H15FN2O3 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-3-(4-fluorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | Cc1cccc(C)c1N1C(=O)C2ON=C(c3ccc(F)cc3)C2C1=O |
| InChI | InChI=1S/C19H15FN2O3/c1-10-4-3-5-11(2)16(10)22-18(23)14-15(21-25-17(14)19(22)24)12-6-8-13(20)9-7-12/h3-9,14,17H,1-2H3 |
| InChIKey | JFLNOABZUVHYEX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|