C17H16F6N2O — CID 4046
[2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol (PubChem CID 4046) has the molecular formula C17H16F6N2O and a molecular weight of 378.32 g/mol. Its IUPAC name is [2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol.
| Compound Name | [2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol |
|---|---|
| PubChem CID | 4046 |
| Molecular Formula | C17H16F6N2O |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol |
| SMILES | OC(c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)C1CCCCN1 |
| InChI | InChI=1S/C17H16F6N2O/c18-16(19,20)11-5-3-4-9-10(15(26)12-6-1-2-7-24-12)8-13(17(21,22)23)25-14(9)11/h3-5,8,12,15,24,26H,1-2,6-7H2 |
| InChIKey | XEEQGYMUWCZPDN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |