C18H20Cl2N2O4S — CID 4046445
2-[4-(butylsulfamoyl)phenoxy]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 4046445) has the molecular formula C18H20Cl2N2O4S and a molecular weight of 431.34 g/mol. Its IUPAC name is 2-[4-(butylsulfamoyl)phenoxy]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[4-(butylsulfamoyl)phenoxy]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4046445 |
| Molecular Formula | C18H20Cl2N2O4S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 2-[4-(butylsulfamoyl)phenoxy]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(OCC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H20Cl2N2O4S/c1-2-3-10-21-27(24,25)15-7-5-14(6-8-15)26-12-18(23)22-13-4-9-16(19)17(20)11-13/h4-9,11,21H,2-3,10,12H2,1H3,(H,22,23) |
| InChIKey | XIFVXMWBYIUSGM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|