C27H35N3O3 — CID 4047713
N-[4-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethoxy]phenyl]-N,2,2-trimethylpropanamide (PubChem CID 4047713) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[4-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethoxy]phenyl]-N,2,2-trimethylpropanamide.
| Compound Name | N-[4-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethoxy]phenyl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 4047713 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | N-[4-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-oxoethoxy]phenyl]-N,2,2-trimethylpropanamide |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=O)COc1ccc(N(C)C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H35N3O3/c1-18-7-12-23-21(15-18)22-16-28(5)14-13-24(22)30(23)25(31)17-33-20-10-8-19(9-11-20)29(6)26(32)27(2,3)4/h7-12,15,22,24H,13-14,16-17H2,1-6H3 |
| InChIKey | KQAFMCZKNKXFKS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |