C29H30N2O5 — CID 4048218
cyclohexyl 2-methyl-4-(4-nitrophenyl)-5-oxo-7-phenyl-4,4a,6,7-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 4048218) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is cyclohexyl 2-methyl-4-(4-nitrophenyl)-5-oxo-7-phenyl-4,4a,6,7-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | cyclohexyl 2-methyl-4-(4-nitrophenyl)-5-oxo-7-phenyl-4,4a,6,7-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 4048218 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | cyclohexyl 2-methyl-4-(4-nitrophenyl)-5-oxo-7-phenyl-4,4a,6,7-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCC2)C(c2ccc([N+](=O)[O-])cc2)C2C(=O)CC(c3ccccc3)C=C2N1 |
| InChI | InChI=1S/C29H30N2O5/c1-18-26(29(33)36-23-10-6-3-7-11-23)27(20-12-14-22(15-13-20)31(34)35)28-24(30-18)16-21(17-25(28)32)19-8-4-2-5-9-19/h2,4-5,8-9,12-16,21,23,27-28,30H,3,6-7,10-11,17H2,1H3 |
| InChIKey | CONBOVQRPGQOJM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|