C19H25NO6 — CID 4049030
3,4,5-trimethoxy-N-[(3,4,5-trimethoxyphenyl)methyl]aniline (PubChem CID 4049030) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(3,4,5-trimethoxyphenyl)methyl]aniline.
| Compound Name | 3,4,5-trimethoxy-N-[(3,4,5-trimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 4049030 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(3,4,5-trimethoxyphenyl)methyl]aniline |
| SMILES | COc1cc(CNc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H25NO6/c1-21-14-7-12(8-15(22-2)18(14)25-5)11-20-13-9-16(23-3)19(26-6)17(10-13)24-4/h7-10,20H,11H2,1-6H3 |
| InChIKey | CXRVPWLVIASLKP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|