About 2-(2-octoxyethoxy)acetic acid
2-(2-octoxyethoxy)acetic acid (PubChem CID 4049161) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-(2-octoxyethoxy)acetic acid.
Molecular Properties
| Compound Name | 2-(2-octoxyethoxy)acetic acid |
| PubChem CID | 4049161 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-(2-octoxyethoxy)acetic acid |
| SMILES | CCCCCCCCOCCOCC(=O)O |
| InChI | InChI=1S/C12H24O4/c1-2-3-4-5-6-7-8-15-9-10-16-11-12(13)14/h2-11H2,1H3,(H,13,14) |
| InChIKey | ICDFAVDDYZOXIU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-octoxyethoxy)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-octoxyethoxy)acetic acid?
The IUPAC name of 2-(2-octoxyethoxy)acetic acid (CID 4049161) is 2-(2-octoxyethoxy)acetic acid.
What is the SMILES notation for 2-(2-octoxyethoxy)acetic acid?
The canonical SMILES for 2-(2-octoxyethoxy)acetic acid is CCCCCCCCOCCOCC(=O)O.
What is the InChIKey of 2-(2-octoxyethoxy)acetic acid?
The InChIKey is ICDFAVDDYZOXIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O4/c1-2-3-4-5-6-7-8-15-9-10-16-11-12(13)14/h2-11H2,1H3,(H,13,14).
What are the key properties of 2-(2-octoxyethoxy)acetic acid?
2-(2-octoxyethoxy)acetic acid has a molecular weight of 232.32 g/mol, XLogP of 2.46, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-octoxyethoxy)acetic acid is sourced from PubChem (CID 4049161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).