C27H28FN5O7S — CID 4049565
N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3,5-dinitrobenzamide (PubChem CID 4049565) has the molecular formula C27H28FN5O7S and a molecular weight of 585.61 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3,5-dinitrobenzamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4049565 |
| Molecular Formula | C27H28FN5O7S |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3,5-dinitrobenzamide |
| SMILES | O=C(CN(CCN1CCOCC1)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N(Cc1ccc(F)cc1)Cc1cccs1 |
| InChI | InChI=1S/C27H28FN5O7S/c28-22-5-3-20(4-6-22)17-31(18-25-2-1-13-41-25)26(34)19-30(8-7-29-9-11-40-12-10-29)27(35)21-14-23(32(36)37)16-24(15-21)33(38)39/h1-6,13-16H,7-12,17-19H2 |
| InChIKey | CLVNTFDHIKLRHJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 139.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|