About methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate
methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate (PubChem CID 4049580) has the molecular formula C18H15N3O3S3
and a molecular weight of 417.54 g/mol. Its IUPAC name is methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate |
| PubChem CID | 4049580 |
| Molecular Formula | C18H15N3O3S3 |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NC(=S)Nc2ccc3nc(SC)sc3c2)cc1 |
| InChI | InChI=1S/C18H15N3O3S3/c1-24-16(23)11-5-3-10(4-6-11)15(22)21-17(25)19-12-7-8-13-14(9-12)27-18(20-13)26-2/h3-9H,1-2H3,(H2,19,21,22,25) |
| InChIKey | UMUDBRGEAMUKCX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate?
The IUPAC name of methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate (CID 4049580) is methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate.
What is the SMILES notation for methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate?
The canonical SMILES for methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate is COC(=O)c1ccc(C(=O)NC(=S)Nc2ccc3nc(SC)sc3c2)cc1.
What is the InChIKey of methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate?
The InChIKey is UMUDBRGEAMUKCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O3S3/c1-24-16(23)11-5-3-10(4-6-11)15(22)21-17(25)19-12-7-8-13-14(9-12)27-18(20-13)26-2/h3-9H,1-2H3,(H2,19,21,22,25).
What are the key properties of methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate?
methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate has a molecular weight of 417.54 g/mol, XLogP of 3.93, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)carbamothioylcarbamoyl]benzoate is sourced from PubChem (CID 4049580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).