C31H24Cl4N2O — CID 4050078
2,4,6,8-tetrakis(4-chlorophenyl)-3,7-diazabicyclo[3.3.1]nonan-9-one (PubChem CID 4050078) has the molecular formula C31H24Cl4N2O and a molecular weight of 582.36 g/mol. Its IUPAC name is 2,4,6,8-tetrakis(4-chlorophenyl)-3,7-diazabicyclo[3.3.1]nonan-9-one.
| Compound Name | 2,4,6,8-tetrakis(4-chlorophenyl)-3,7-diazabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 4050078 |
| Molecular Formula | C31H24Cl4N2O |
| Molecular Weight | 582.36 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | 2,4,6,8-tetrakis(4-chlorophenyl)-3,7-diazabicyclo[3.3.1]nonan-9-one |
| SMILES | O=C1C2C(c3ccc(Cl)cc3)NC(c3ccc(Cl)cc3)C1C(c1ccc(Cl)cc1)NC2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H24Cl4N2O/c32-21-9-1-17(2-10-21)27-25-28(18-3-11-22(33)12-4-18)37-30(20-7-15-24(35)16-8-20)26(31(25)38)29(36-27)19-5-13-23(34)14-6-19/h1-16,25-30,36-37H |
| InChIKey | UMRURHBFKPCEAV-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.36 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |