C16H27N7O2 — CID 40504586
2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 40504586) has the molecular formula C16H27N7O2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 40504586 |
| Molecular Formula | C16H27N7O2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2nc(N)c([N+](=O)[O-])c(N3CCN(C)CC3)n2)C1 |
| InChI | InChI=1S/C16H27N7O2/c1-11-8-12(2)10-22(9-11)16-18-14(17)13(23(24)25)15(19-16)21-6-4-20(3)5-7-21/h11-12H,4-10H2,1-3H3,(H2,17,18,19)/t11-,12-/m1/s1 |
| InChIKey | HFYLUMZDQLOWSC-VXGBXAGGSA-N |
| XLogP | 1.20 |
| TPSA | 104.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|