C25H23N3O — CID 40504936
(4S)-4-(1-benzylbenzimidazol-2-yl)-1-(3-methylphenyl)pyrrolidin-2-one (PubChem CID 40504936) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is (4S)-4-(1-benzylbenzimidazol-2-yl)-1-(3-methylphenyl)pyrrolidin-2-one.
| Compound Name | (4S)-4-(1-benzylbenzimidazol-2-yl)-1-(3-methylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 40504936 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (4S)-4-(1-benzylbenzimidazol-2-yl)-1-(3-methylphenyl)pyrrolidin-2-one |
| SMILES | Cc1cccc(N2C[C@@H](c3nc4ccccc4n3Cc3ccccc3)CC2=O)c1 |
| InChI | InChI=1S/C25H23N3O/c1-18-8-7-11-21(14-18)27-17-20(15-24(27)29)25-26-22-12-5-6-13-23(22)28(25)16-19-9-3-2-4-10-19/h2-14,20H,15-17H2,1H3/t20-/m0/s1 |
| InChIKey | CXEYNKDPUJDOHJ-FQEVSTJZSA-N |
| XLogP | 4.91 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |