About 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid
4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid (PubChem CID 4050539) has the molecular formula C17H10O4
and a molecular weight of 278.26 g/mol. Its IUPAC name is 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid |
| PubChem CID | 4050539 |
| Molecular Formula | C17H10O4 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=C2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H10O4/c18-15-12-3-1-2-4-13(12)16(19)14(15)9-10-5-7-11(8-6-10)17(20)21/h1-9H,(H,20,21) |
| InChIKey | OZERJBZWEUIVKH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid?
The IUPAC name of 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid (CID 4050539) is 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid.
What is the SMILES notation for 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid?
The canonical SMILES for 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid is O=C(O)c1ccc(C=C2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid?
The InChIKey is OZERJBZWEUIVKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10O4/c18-15-12-3-1-2-4-13(12)16(19)14(15)9-10-5-7-11(8-6-10)17(20)21/h1-9H,(H,20,21).
What are the key properties of 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid?
4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid has a molecular weight of 278.26 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid is sourced from PubChem (CID 4050539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).