About 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one
6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one (PubChem CID 4050913) has the molecular formula C18H15NO4S
and a molecular weight of 341.39 g/mol. Its IUPAC name is 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one.
Molecular Properties
| Compound Name | 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one |
| PubChem CID | 4050913 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one |
| SMILES | Cc1ccc2c(c1)CCN2S(=O)(=O)c1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C18H15NO4S/c1-12-2-5-16-13(10-12)8-9-19(16)24(21,22)15-4-6-17-14(11-15)3-7-18(20)23-17/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | HLVQVMMYZLVIGV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one?
The IUPAC name of 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one (CID 4050913) is 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one.
What is the SMILES notation for 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one?
The canonical SMILES for 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one is Cc1ccc2c(c1)CCN2S(=O)(=O)c1ccc2oc(=O)ccc2c1.
What is the InChIKey of 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one?
The InChIKey is HLVQVMMYZLVIGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO4S/c1-12-2-5-16-13(10-12)8-9-19(16)24(21,22)15-4-6-17-14(11-15)3-7-18(20)23-17/h2-7,10-11H,8-9H2,1H3.
What are the key properties of 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one?
6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one has a molecular weight of 341.39 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-methyl-2,3-dihydroindol-1-yl)sulfonyl]chromen-2-one is sourced from PubChem (CID 4050913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).