C21H16N4O4S — CID 4051011
2-(3,4-dimethylphenyl)imino-6-nitro-N-(1,3-thiazol-2-yl)chromene-3-carboxamide (PubChem CID 4051011) has the molecular formula C21H16N4O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)imino-6-nitro-N-(1,3-thiazol-2-yl)chromene-3-carboxamide.
| Compound Name | 2-(3,4-dimethylphenyl)imino-6-nitro-N-(1,3-thiazol-2-yl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 4051011 |
| Molecular Formula | C21H16N4O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-(3,4-dimethylphenyl)imino-6-nitro-N-(1,3-thiazol-2-yl)chromene-3-carboxamide |
| SMILES | Cc1ccc(/N=c2\oc3ccc([N+](=O)[O-])cc3cc2C(=O)Nc2nccs2)cc1C |
| InChI | InChI=1S/C21H16N4O4S/c1-12-3-4-15(9-13(12)2)23-20-17(19(26)24-21-22-7-8-30-21)11-14-10-16(25(27)28)5-6-18(14)29-20/h3-11H,1-2H3,(H,22,24,26)/b23-20- |
| InChIKey | GFDSZVQBNYQADF-ATJXCDBQSA-N |
| XLogP | 4.90 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|