C15H16N2O3 — CID 40511701
(4S)-5-acetyl-4-(3-ethenyl-2-hydroxyphenyl)-6-methyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 40511701) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is (4S)-5-acetyl-4-(3-ethenyl-2-hydroxyphenyl)-6-methyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | (4S)-5-acetyl-4-(3-ethenyl-2-hydroxyphenyl)-6-methyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 40511701 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (4S)-5-acetyl-4-(3-ethenyl-2-hydroxyphenyl)-6-methyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | C=Cc1cccc([C@@H]2NC(=O)NC(C)=C2C(C)=O)c1O |
| InChI | InChI=1S/C15H16N2O3/c1-4-10-6-5-7-11(14(10)19)13-12(9(3)18)8(2)16-15(20)17-13/h4-7,13,19H,1H2,2-3H3,(H2,16,17,20)/t13-/m0/s1 |
| InChIKey | QIZPJWMZRHZZDL-ZDUSSCGKSA-N |
| XLogP | 2.25 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|