C32H56N4 — CID 40513160
2,7,13,17-tetraethyl-3,8,12,18-tetramethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,21,22,23,24-icosahydroporphyrin (PubChem CID 40513160) has the molecular formula C32H56N4 and a molecular weight of 496.83 g/mol. Its IUPAC name is 2,7,13,17-tetraethyl-3,8,12,18-tetramethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,21,22,23,24-icosahydroporphyrin.
| Compound Name | 2,7,13,17-tetraethyl-3,8,12,18-tetramethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,21,22,23,24-icosahydroporphyrin |
|---|---|
| PubChem CID | 40513160 |
| Molecular Formula | C32H56N4 |
| Molecular Weight | 496.83 g/mol |
| Exact Mass | 496.45 |
| IUPAC Name | 2,7,13,17-tetraethyl-3,8,12,18-tetramethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,21,22,23,24-icosahydroporphyrin |
| SMILES | CCC1=C(C)C2CC3NC(CC4NC(CC5NC(CC1N2)C(C)C5CC)C(C)=C4CC)C(CC)C3C |
| InChI | InChI=1S/C32H56N4/c1-9-21-17(5)25-13-26-18(6)23(11-3)31(34-26)16-32-24(12-4)20(8)28(36-32)15-30-22(10-2)19(7)27(35-30)14-29(21)33-25/h18-19,22-23,25-36H,9-16H2,1-8H3 |
| InChIKey | SEPCMYDYRISWPO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.83 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|