About 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile
2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile (PubChem CID 40513534) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile |
| PubChem CID | 40513534 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile |
| SMILES | CC1=NC(C)=C(C#N)CC1C#N |
| InChI | InChI=1S/C9H9N3/c1-6-8(4-10)3-9(5-11)7(2)12-6/h8H,3H2,1-2H3 |
| InChIKey | ASZLXYDZNBOFTR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile?
The IUPAC name of 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile (CID 40513534) is 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile?
The canonical SMILES for 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile is CC1=NC(C)=C(C#N)CC1C#N.
What is the InChIKey of 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile?
The InChIKey is ASZLXYDZNBOFTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c1-6-8(4-10)3-9(5-11)7(2)12-6/h8H,3H2,1-2H3.
What are the key properties of 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile?
2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile has a molecular weight of 159.19 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-3,4-dihydropyridine-3,5-dicarbonitrile is sourced from PubChem (CID 40513534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).