C10H13N3O4 — CID 4051591
ethyl 5-ethyl-4,6-dioxo-2,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 4051591) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is ethyl 5-ethyl-4,6-dioxo-2,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-ethyl-4,6-dioxo-2,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 4051591 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | ethyl 5-ethyl-4,6-dioxo-2,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=C2C(=O)N(CC)C(=O)C2NN1 |
| InChI | InChI=1S/C10H13N3O4/c1-3-13-8(14)5-6(9(13)15)11-12-7(5)10(16)17-4-2/h6,11-12H,3-4H2,1-2H3 |
| InChIKey | NOKIANWZMSODLG-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|