C15H16NO5S- — CID 4051680
4-[(3-methoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobut-2-enoate (PubChem CID 4051680) has the molecular formula C15H16NO5S- and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-[(3-methoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobut-2-enoate.
| Compound Name | 4-[(3-methoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 4051680 |
| Molecular Formula | C15H16NO5S- |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-[(3-methoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobut-2-enoate |
| SMILES | COC(=O)c1c(NC(=O)C=CC(=O)[O-])sc2c1CCC(C)C2 |
| InChI | InChI=1S/C15H17NO5S/c1-8-3-4-9-10(7-8)22-14(13(9)15(20)21-2)16-11(17)5-6-12(18)19/h5-6,8H,3-4,7H2,1-2H3,(H,16,17)(H,18,19)/p-1 |
| InChIKey | RSALICGIYNRVAK-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|