C21H20N4O3S — CID 40518875
4-[(4-nitrophenyl)methylsulfanyl]-1-(pyridin-2-ylmethyl)-5,6,7,8-tetrahydroquinazolin-2-one (PubChem CID 40518875) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 4-[(4-nitrophenyl)methylsulfanyl]-1-(pyridin-2-ylmethyl)-5,6,7,8-tetrahydroquinazolin-2-one.
| Compound Name | 4-[(4-nitrophenyl)methylsulfanyl]-1-(pyridin-2-ylmethyl)-5,6,7,8-tetrahydroquinazolin-2-one |
|---|---|
| PubChem CID | 40518875 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-[(4-nitrophenyl)methylsulfanyl]-1-(pyridin-2-ylmethyl)-5,6,7,8-tetrahydroquinazolin-2-one |
| SMILES | O=c1nc(SCc2ccc([N+](=O)[O-])cc2)c2c(n1Cc1ccccn1)CCCC2 |
| InChI | InChI=1S/C21H20N4O3S/c26-21-23-20(29-14-15-8-10-17(11-9-15)25(27)28)18-6-1-2-7-19(18)24(21)13-16-5-3-4-12-22-16/h3-5,8-12H,1-2,6-7,13-14H2 |
| InChIKey | RNKRZQLVYARHPG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|