C43H51F3N2O6 — CID 4051972
1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea (PubChem CID 4051972) has the molecular formula C43H51F3N2O6 and a molecular weight of 748.88 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 4051972 |
| Molecular Formula | C43H51F3N2O6 |
| Molecular Weight | 748.88 g/mol |
| Exact Mass | 748.37 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea |
| SMILES | COc1ccc(NC(=O)N(CC2CCCO2)CC2(O)CCC3c4ccc(cc4C(=O)c4cccc(C(F)(F)F)c4)CC(O)CCC(C)=CCCC32C)cc1 |
| InChI | InChI=1S/C43H51F3N2O6/c1-28-7-5-20-41(2)38(19-21-42(41,52)27-48(26-35-10-6-22-54-35)40(51)47-32-13-16-34(53-3)17-14-32)36-18-12-29(23-33(49)15-11-28)24-37(36)39(50)30-8-4-9-31(25-30)43(44,45)46/h4,7-9,12-14,16-18,24-25,33,35,38,49,52H,5-6,10-11,15,19-23,26-27H2,1-3H3,(H,47,51) |
| InChIKey | XNJTZXGGEIAYDL-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.88 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|